C26H50N3O11P — CID 154363623
butyl 2-[[N'-[bis(4-butoxycarbonyloxybutoxy)phosphoryl]carbamimidoyl]-methylamino]acetate (PubChem CID 154363623) has the molecular formula C26H50N3O11P and a molecular weight of 611.67 g/mol. Its IUPAC name is butyl 2-[[N'-[bis(4-butoxycarbonyloxybutoxy)phosphoryl]carbamimidoyl]-methylamino]acetate.
| Compound Name | butyl 2-[[N'-[bis(4-butoxycarbonyloxybutoxy)phosphoryl]carbamimidoyl]-methylamino]acetate |
|---|---|
| PubChem CID | 154363623 |
| Molecular Formula | C26H50N3O11P |
| Molecular Weight | 611.67 g/mol |
| Exact Mass | 611.32 |
| IUPAC Name | butyl 2-[[N'-[bis(4-butoxycarbonyloxybutoxy)phosphoryl]carbamimidoyl]-methylamino]acetate |
| SMILES | CCCCOC(=O)CN(C)C(N)=NP(=O)(OCCCCOC(=O)OCCCC)OCCCCOC(=O)OCCCC |
| InChI | InChI=1S/C26H50N3O11P/c1-5-8-15-34-23(30)22-29(4)24(27)28-41(33,39-20-13-11-18-37-25(31)35-16-9-6-2)40-21-14-12-19-38-26(32)36-17-10-7-3/h5-22H2,1-4H3,(H2,27,28,33) |
| InChIKey | ZJDDYQDOERMMJF-UHFFFAOYSA-N |
| XLogP | 5.18 |
| TPSA | 174.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 24 |
| Heavy Atoms | 41 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 611.67 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|