C33H48N3O11P — CID 140520465
propyl 2-[[(E)-N'-[bis[3-(3-phenylpropoxycarbonyloxy)propoxy]phosphoryl]carbamimidoyl]-methylamino]acetate (PubChem CID 140520465) has the molecular formula C33H48N3O11P and a molecular weight of 693.73 g/mol. Its IUPAC name is propyl 2-[[(E)-N'-[bis[3-(3-phenylpropoxycarbonyloxy)propoxy]phosphoryl]carbamimidoyl]-methylamino]acetate.
| Compound Name | propyl 2-[[(E)-N'-[bis[3-(3-phenylpropoxycarbonyloxy)propoxy]phosphoryl]carbamimidoyl]-methylamino]acetate |
|---|---|
| PubChem CID | 140520465 |
| Molecular Formula | C33H48N3O11P |
| Molecular Weight | 693.73 g/mol |
| Exact Mass | 693.30 |
| IUPAC Name | propyl 2-[[(E)-N'-[bis[3-(3-phenylpropoxycarbonyloxy)propoxy]phosphoryl]carbamimidoyl]-methylamino]acetate |
| SMILES | CCCOC(=O)CN(C)/C(N)=N/P(=O)(OCCCOC(=O)OCCCc1ccccc1)OCCCOC(=O)OCCCc1ccccc1 |
| InChI | InChI=1S/C33H48N3O11P/c1-3-20-41-30(37)27-36(2)31(34)35-48(40,46-25-12-23-44-32(38)42-21-10-18-28-14-6-4-7-15-28)47-26-13-24-45-33(39)43-22-11-19-29-16-8-5-9-17-29/h4-9,14-17H,3,10-13,18-27H2,1-2H3,(H2,34,35,40) |
| InChIKey | BWOGFUSPNMZIBE-UHFFFAOYSA-N |
| XLogP | 5.68 |
| TPSA | 174.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 23 |
| Heavy Atoms | 48 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 693.73 |
| LogP ≤ 5 | 5.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|