C16H30N3O11P — CID 154316355
ethyl 2-[[N'-[bis(2-ethoxycarbonyloxyethoxy)phosphoryl]carbamimidoyl]-methylamino]acetate (PubChem CID 154316355) has the molecular formula C16H30N3O11P and a molecular weight of 471.40 g/mol. Its IUPAC name is ethyl 2-[[N'-[bis(2-ethoxycarbonyloxyethoxy)phosphoryl]carbamimidoyl]-methylamino]acetate.
| Compound Name | ethyl 2-[[N'-[bis(2-ethoxycarbonyloxyethoxy)phosphoryl]carbamimidoyl]-methylamino]acetate |
|---|---|
| PubChem CID | 154316355 |
| Molecular Formula | C16H30N3O11P |
| Molecular Weight | 471.40 g/mol |
| Exact Mass | 471.16 |
| IUPAC Name | ethyl 2-[[N'-[bis(2-ethoxycarbonyloxyethoxy)phosphoryl]carbamimidoyl]-methylamino]acetate |
| SMILES | CCOC(=O)CN(C)C(N)=NP(=O)(OCCOC(=O)OCC)OCCOC(=O)OCC |
| InChI | InChI=1S/C16H30N3O11P/c1-5-24-13(20)12-19(4)14(17)18-31(23,29-10-8-27-15(21)25-6-2)30-11-9-28-16(22)26-7-3/h5-12H2,1-4H3,(H2,17,18,23) |
| InChIKey | JZLUETCSVRGDOT-UHFFFAOYSA-N |
| XLogP | 1.28 |
| TPSA | 174.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.40 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|