C32H62N3O11P — CID 140520365
butyl 2-[[(E)-N'-[bis(3-octoxycarbonyloxypropoxy)phosphoryl]carbamimidoyl]-methylamino]acetate (PubChem CID 140520365) has the molecular formula C32H62N3O11P and a molecular weight of 695.83 g/mol. Its IUPAC name is butyl 2-[[(E)-N'-[bis(3-octoxycarbonyloxypropoxy)phosphoryl]carbamimidoyl]-methylamino]acetate.
| Compound Name | butyl 2-[[(E)-N'-[bis(3-octoxycarbonyloxypropoxy)phosphoryl]carbamimidoyl]-methylamino]acetate |
|---|---|
| PubChem CID | 140520365 |
| Molecular Formula | C32H62N3O11P |
| Molecular Weight | 695.83 g/mol |
| Exact Mass | 695.41 |
| IUPAC Name | butyl 2-[[(E)-N'-[bis(3-octoxycarbonyloxypropoxy)phosphoryl]carbamimidoyl]-methylamino]acetate |
| SMILES | CCCCCCCCOC(=O)OCCCOP(=O)(/N=C(\N)N(C)CC(=O)OCCCC)OCCCOC(=O)OCCCCCCCC |
| InChI | InChI=1S/C32H62N3O11P/c1-5-8-11-13-15-17-22-41-31(37)43-24-19-26-45-47(39,34-30(33)35(4)28-29(36)40-21-10-7-3)46-27-20-25-44-32(38)42-23-18-16-14-12-9-6-2/h5-28H2,1-4H3,(H2,33,34,39) |
| InChIKey | LPMYYVDRHUWYMR-UHFFFAOYSA-N |
| XLogP | 7.53 |
| TPSA | 174.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 30 |
| Heavy Atoms | 47 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 695.83 |
| LogP ≤ 5 | 7.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|