C37H64N3O11P — CID 91365761
2-[[N'-bis(2-methyl-1-octoxycarbonyloxypropoxy)phosphorylcarbamimidoyl]-methylamino]-3-phenylpropanoic acid (PubChem CID 91365761) has the molecular formula C37H64N3O11P and a molecular weight of 757.90 g/mol. Its IUPAC name is 2-[[N'-bis(2-methyl-1-octoxycarbonyloxypropoxy)phosphorylcarbamimidoyl]-methylamino]-3-phenylpropanoic acid.
| Compound Name | 2-[[N'-bis(2-methyl-1-octoxycarbonyloxypropoxy)phosphorylcarbamimidoyl]-methylamino]-3-phenylpropanoic acid |
|---|---|
| PubChem CID | 91365761 |
| Molecular Formula | C37H64N3O11P |
| Molecular Weight | 757.90 g/mol |
| Exact Mass | 757.43 |
| IUPAC Name | 2-[[N'-bis(2-methyl-1-octoxycarbonyloxypropoxy)phosphorylcarbamimidoyl]-methylamino]-3-phenylpropanoic acid |
| SMILES | CCCCCCCCOC(=O)OC(OP(=O)(N=C(N)N(C)C(Cc1ccccc1)C(=O)O)OC(OC(=O)OCCCCCCCC)C(C)C)C(C)C |
| InChI | InChI=1S/C37H64N3O11P/c1-8-10-12-14-16-21-25-46-36(43)48-33(28(3)4)50-52(45,39-35(38)40(7)31(32(41)42)27-30-23-19-18-20-24-30)51-34(29(5)6)49-37(44)47-26-22-17-15-13-11-9-2/h18-20,23-24,28-29,31,33-34H,8-17,21-22,25-27H2,1-7H3,(H,41,42)(H2,38,39,45) |
| InChIKey | CVBLBTUYNHQPHZ-UHFFFAOYSA-N |
| XLogP | 9.06 |
| TPSA | 185.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 27 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 757.90 |
| LogP ≤ 5 | 9.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|