C21H31N3O11P- — CID 86616691
2-[[N'-[bis(propan-2-yloxycarbonyloxymethoxy)phosphoryl]carbamimidoyl]-methylamino]-3-phenylpropanoate (PubChem CID 86616691) has the molecular formula C21H31N3O11P- and a molecular weight of 532.46 g/mol. Its IUPAC name is 2-[[N'-[bis(propan-2-yloxycarbonyloxymethoxy)phosphoryl]carbamimidoyl]-methylamino]-3-phenylpropanoate.
| Compound Name | 2-[[N'-[bis(propan-2-yloxycarbonyloxymethoxy)phosphoryl]carbamimidoyl]-methylamino]-3-phenylpropanoate |
|---|---|
| PubChem CID | 86616691 |
| Molecular Formula | C21H31N3O11P- |
| Molecular Weight | 532.46 g/mol |
| Exact Mass | 532.17 |
| IUPAC Name | 2-[[N'-[bis(propan-2-yloxycarbonyloxymethoxy)phosphoryl]carbamimidoyl]-methylamino]-3-phenylpropanoate |
| SMILES | CC(C)OC(=O)OCOP(=O)(N=C(N)N(C)C(Cc1ccccc1)C(=O)[O-])OCOC(=O)OC(C)C |
| InChI | InChI=1S/C21H32N3O11P/c1-14(2)34-20(27)30-12-32-36(29,33-13-31-21(28)35-15(3)4)23-19(22)24(5)17(18(25)26)11-16-9-7-6-8-10-16/h6-10,14-15,17H,11-13H2,1-5H3,(H,25,26)(H2,22,23,29)/p-1 |
| InChIKey | XHFPKOTUMBGMBN-UHFFFAOYSA-M |
| XLogP | 1.77 |
| TPSA | 188.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.46 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|