C33H48N3O11P — CID 90887016
2-[[N'-bis[2-methyl-1-(2-phenylethoxycarbonyloxy)propoxy]phosphorylcarbamimidoyl]-methylamino]-3-methylbutanoic acid (PubChem CID 90887016) has the molecular formula C33H48N3O11P and a molecular weight of 693.73 g/mol. Its IUPAC name is 2-[[N'-bis[2-methyl-1-(2-phenylethoxycarbonyloxy)propoxy]phosphorylcarbamimidoyl]-methylamino]-3-methylbutanoic acid.
| Compound Name | 2-[[N'-bis[2-methyl-1-(2-phenylethoxycarbonyloxy)propoxy]phosphorylcarbamimidoyl]-methylamino]-3-methylbutanoic acid |
|---|---|
| PubChem CID | 90887016 |
| Molecular Formula | C33H48N3O11P |
| Molecular Weight | 693.73 g/mol |
| Exact Mass | 693.30 |
| IUPAC Name | 2-[[N'-bis[2-methyl-1-(2-phenylethoxycarbonyloxy)propoxy]phosphorylcarbamimidoyl]-methylamino]-3-methylbutanoic acid |
| SMILES | CC(C)C(OC(=O)OCCc1ccccc1)OP(=O)(N=C(N)N(C)C(C(=O)O)C(C)C)OC(OC(=O)OCCc1ccccc1)C(C)C |
| InChI | InChI=1S/C33H48N3O11P/c1-22(2)27(28(37)38)36(7)31(34)35-48(41,46-29(23(3)4)44-32(39)42-20-18-25-14-10-8-11-15-25)47-30(24(5)6)45-33(40)43-21-19-26-16-12-9-13-17-26/h8-17,22-24,27,29-30H,18-21H2,1-7H3,(H,37,38)(H2,34,35,41) |
| InChIKey | RRNQOHMCFSBKST-UHFFFAOYSA-N |
| XLogP | 6.24 |
| TPSA | 185.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 693.73 |
| LogP ≤ 5 | 6.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|