C7H11NO5 — CID 121390047
3-[[(1S)-1-carboxyethyl]-methylamino]-3-oxopropanoic acid (PubChem CID 121390047) has the molecular formula C7H11NO5 and a molecular weight of 189.17 g/mol. Its IUPAC name is 3-[[(1S)-1-carboxyethyl]-methylamino]-3-oxopropanoic acid.
| Compound Name | 3-[[(1S)-1-carboxyethyl]-methylamino]-3-oxopropanoic acid |
|---|---|
| PubChem CID | 121390047 |
| Molecular Formula | C7H11NO5 |
| Molecular Weight | 189.17 g/mol |
| Exact Mass | 189.06 |
| IUPAC Name | 3-[[(1S)-1-carboxyethyl]-methylamino]-3-oxopropanoic acid |
| SMILES | C[C@@H](C(=O)O)N(C)C(=O)CC(=O)O |
| InChI | InChI=1S/C7H11NO5/c1-4(7(12)13)8(2)5(9)3-6(10)11/h4H,3H2,1-2H3,(H,10,11)(H,12,13)/t4-/m0/s1 |
| InChIKey | RGOOWSSCEBLVFI-BYPYZUCNSA-N |
| XLogP | -0.61 |
| TPSA | 94.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 189.17 |
| LogP ≤ 5 | -0.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|