C9H17NO3S — CID 145294959
(2S)-2-[methyl(4-sulfanylpentanoyl)amino]propanoic acid (PubChem CID 145294959) has the molecular formula C9H17NO3S and a molecular weight of 219.31 g/mol. Its IUPAC name is (2S)-2-[methyl(4-sulfanylpentanoyl)amino]propanoic acid.
| Compound Name | (2S)-2-[methyl(4-sulfanylpentanoyl)amino]propanoic acid |
|---|---|
| PubChem CID | 145294959 |
| Molecular Formula | C9H17NO3S |
| Molecular Weight | 219.31 g/mol |
| Exact Mass | 219.09 |
| IUPAC Name | (2S)-2-[methyl(4-sulfanylpentanoyl)amino]propanoic acid |
| SMILES | CC(S)CCC(=O)N(C)[C@@H](C)C(=O)O |
| InChI | InChI=1S/C9H17NO3S/c1-6(14)4-5-8(11)10(3)7(2)9(12)13/h6-7,14H,4-5H2,1-3H3,(H,12,13)/t6?,7-/m0/s1 |
| InChIKey | VLGLDAZEDISRRL-MLWJPKLSSA-N |
| XLogP | 1.02 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.31 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|