C5H11N3O5P+ — CID 173300431
[[amino-[1-carboxyethyl(methyl)amino]methylidene]amino]oxy-hydroxy-oxophosphanium (PubChem CID 173300431) has the molecular formula C5H11N3O5P+ and a molecular weight of 224.13 g/mol. Its IUPAC name is [[amino-[1-carboxyethyl(methyl)amino]methylidene]amino]oxy-hydroxy-oxophosphanium.
| Compound Name | [[amino-[1-carboxyethyl(methyl)amino]methylidene]amino]oxy-hydroxy-oxophosphanium |
|---|---|
| PubChem CID | 173300431 |
| Molecular Formula | C5H11N3O5P+ |
| Molecular Weight | 224.13 g/mol |
| Exact Mass | 224.04 |
| IUPAC Name | [[amino-[1-carboxyethyl(methyl)amino]methylidene]amino]oxy-hydroxy-oxophosphanium |
| SMILES | CC(C(=O)O)N(C)C(N)=NO[P+](=O)O |
| InChI | InChI=1S/C5H10N3O5P/c1-3(4(9)10)8(2)5(6)7-13-14(11)12/h3H,1-2H3,(H3-,6,7,9,10,11,12)/p+1 |
| InChIKey | SULVREQYFLGEMV-UHFFFAOYSA-O |
| XLogP | -0.71 |
| TPSA | 125.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.13 |
| LogP ≤ 5 | -0.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|