C3H6O5P+ — CID 88801828
1-carboxyethoxy-hydroxy-oxophosphanium (PubChem CID 88801828) has the molecular formula C3H6O5P+ and a molecular weight of 153.05 g/mol. Its IUPAC name is 1-carboxyethoxy-hydroxy-oxophosphanium.
| Compound Name | 1-carboxyethoxy-hydroxy-oxophosphanium |
|---|---|
| PubChem CID | 88801828 |
| Molecular Formula | C3H6O5P+ |
| Molecular Weight | 153.05 g/mol |
| Exact Mass | 152.99 |
| IUPAC Name | 1-carboxyethoxy-hydroxy-oxophosphanium |
| SMILES | CC(O[P+](=O)O)C(=O)O |
| InChI | InChI=1S/C3H5O5P/c1-2(3(4)5)8-9(6)7/h2H,1H3,(H-,4,5,6,7)/p+1 |
| InChIKey | BCOWRWYTSXOKHJ-UHFFFAOYSA-O |
| XLogP | 0.13 |
| TPSA | 83.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 153.05 |
| LogP ≤ 5 | 0.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|