C3H8O5P+ — CID 88613904
[(1S,2S)-1,2-dihydroxypropoxy]-hydroxy-oxophosphanium (PubChem CID 88613904) has the molecular formula C3H8O5P+ and a molecular weight of 155.07 g/mol. Its IUPAC name is [(1S,2S)-1,2-dihydroxypropoxy]-hydroxy-oxophosphanium.
| Compound Name | [(1S,2S)-1,2-dihydroxypropoxy]-hydroxy-oxophosphanium |
|---|---|
| PubChem CID | 88613904 |
| Molecular Formula | C3H8O5P+ |
| Molecular Weight | 155.07 g/mol |
| Exact Mass | 155.01 |
| IUPAC Name | [(1S,2S)-1,2-dihydroxypropoxy]-hydroxy-oxophosphanium |
| SMILES | C[C@H](O)[C@@H](O)O[P+](=O)O |
| InChI | InChI=1S/C3H7O5P/c1-2(4)3(5)8-9(6)7/h2-5H,1H3/p+1/t2-,3-/m0/s1 |
| InChIKey | DXRWGTWGWCHYQK-HRFVKAFMSA-O |
| XLogP | -0.65 |
| TPSA | 86.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 155.07 |
| LogP ≤ 5 | -0.65 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|