C3H9NO4P+ — CID 87190304
[(1R,2R)-1-amino-2-hydroxypropoxy]-hydroxy-oxophosphanium (PubChem CID 87190304) has the molecular formula C3H9NO4P+ and a molecular weight of 154.08 g/mol. Its IUPAC name is [(1R,2R)-1-amino-2-hydroxypropoxy]-hydroxy-oxophosphanium.
| Compound Name | [(1R,2R)-1-amino-2-hydroxypropoxy]-hydroxy-oxophosphanium |
|---|---|
| PubChem CID | 87190304 |
| Molecular Formula | C3H9NO4P+ |
| Molecular Weight | 154.08 g/mol |
| Exact Mass | 154.03 |
| IUPAC Name | [(1R,2R)-1-amino-2-hydroxypropoxy]-hydroxy-oxophosphanium |
| SMILES | C[C@@H](O)[C@H](N)O[P+](=O)O |
| InChI | InChI=1S/C3H8NO4P/c1-2(5)3(4)8-9(6)7/h2-3,5H,4H2,1H3/p+1/t2-,3-/m1/s1 |
| InChIKey | KWOPAVHARGOLQY-PWNYCUMCSA-O |
| XLogP | -0.68 |
| TPSA | 92.78 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 154.08 |
| LogP ≤ 5 | -0.68 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|