About hydroxy-(2-methylpropoxy)-oxophosphanium;2-methylpropane
hydroxy-(2-methylpropoxy)-oxophosphanium;2-methylpropane (PubChem CID 87604584) has the molecular formula C8H20O3P+
and a molecular weight of 195.22 g/mol. Its IUPAC name is hydroxy-(2-methylpropoxy)-oxophosphanium;2-methylpropane.
Molecular Properties
| Compound Name | hydroxy-(2-methylpropoxy)-oxophosphanium;2-methylpropane |
| PubChem CID | 87604584 |
| Molecular Formula | C8H20O3P+ |
| Molecular Weight | 195.22 g/mol |
| Exact Mass | 195.11 |
| IUPAC Name | hydroxy-(2-methylpropoxy)-oxophosphanium;2-methylpropane |
| SMILES | CC(C)C.CC(C)CO[P+](=O)O |
| InChI | InChI=1S/C4H9O3P.C4H10/c1-4(2)3-7-8(5)6;1-4(2)3/h4H,3H2,1-2H3;4H,1-3H3/p+1 |
| InChIKey | KCECBAHJXDOQDD-UHFFFAOYSA-O |
| XLogP | 2.97 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 195.22 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze hydroxy-(2-methylpropoxy)-oxophosphanium;2-methylpropane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of hydroxy-(2-methylpropoxy)-oxophosphanium;2-methylpropane?
The IUPAC name of hydroxy-(2-methylpropoxy)-oxophosphanium;2-methylpropane (CID 87604584) is hydroxy-(2-methylpropoxy)-oxophosphanium;2-methylpropane.
What is the SMILES notation for hydroxy-(2-methylpropoxy)-oxophosphanium;2-methylpropane?
The canonical SMILES for hydroxy-(2-methylpropoxy)-oxophosphanium;2-methylpropane is CC(C)C.CC(C)CO[P+](=O)O.
What is the InChIKey of hydroxy-(2-methylpropoxy)-oxophosphanium;2-methylpropane?
The InChIKey is KCECBAHJXDOQDD-UHFFFAOYSA-O. The full InChI is InChI=1S/C4H9O3P.C4H10/c1-4(2)3-7-8(5)6;1-4(2)3/h4H,3H2,1-2H3;4H,1-3H3/p+1.
What are the key properties of hydroxy-(2-methylpropoxy)-oxophosphanium;2-methylpropane?
hydroxy-(2-methylpropoxy)-oxophosphanium;2-methylpropane has a molecular weight of 195.22 g/mol, XLogP of 2.97, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for hydroxy-(2-methylpropoxy)-oxophosphanium;2-methylpropane is sourced from PubChem (CID 87604584), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).