C3H7O5PS — CID 174516434
1-[hydroxy(oxo)phosphaniumyl]oxypropane-2-sulfinate (PubChem CID 174516434) has the molecular formula C3H7O5PS and a molecular weight of 186.12 g/mol. Its IUPAC name is 1-[hydroxy(oxo)phosphaniumyl]oxypropane-2-sulfinate.
| Compound Name | 1-[hydroxy(oxo)phosphaniumyl]oxypropane-2-sulfinate |
|---|---|
| PubChem CID | 174516434 |
| Molecular Formula | C3H7O5PS |
| Molecular Weight | 186.12 g/mol |
| Exact Mass | 185.98 |
| IUPAC Name | 1-[hydroxy(oxo)phosphaniumyl]oxypropane-2-sulfinate |
| SMILES | CC(CO[P+](=O)O)S(=O)[O-] |
| InChI | InChI=1S/C3H7O5PS/c1-3(10(6)7)2-8-9(4)5/h3H,2H2,1H3,(H-,4,5,6,7) |
| InChIKey | KKSAKVYEPVJOCG-UHFFFAOYSA-N |
| XLogP | -0.08 |
| TPSA | 86.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 186.12 |
| LogP ≤ 5 | -0.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|