C6H12O10P2+2 — CID 172809163
hydroxy-oxo-[(2R,3S,4S)-2,3,4-trihydroxy-6-[hydroxy(oxo)phosphaniumyl]oxy-5-oxohexoxy]phosphanium (PubChem CID 172809163) has the molecular formula C6H12O10P2+2 and a molecular weight of 306.10 g/mol. Its IUPAC name is hydroxy-oxo-[(2R,3S,4S)-2,3,4-trihydroxy-6-[hydroxy(oxo)phosphaniumyl]oxy-5-oxohexoxy]phosphanium.
| Compound Name | hydroxy-oxo-[(2R,3S,4S)-2,3,4-trihydroxy-6-[hydroxy(oxo)phosphaniumyl]oxy-5-oxohexoxy]phosphanium |
|---|---|
| PubChem CID | 172809163 |
| Molecular Formula | C6H12O10P2+2 |
| Molecular Weight | 306.10 g/mol |
| Exact Mass | 305.99 |
| IUPAC Name | hydroxy-oxo-[(2R,3S,4S)-2,3,4-trihydroxy-6-[hydroxy(oxo)phosphaniumyl]oxy-5-oxohexoxy]phosphanium |
| SMILES | O=C(CO[P+](=O)O)[C@@H](O)[C@@H](O)[C@H](O)CO[P+](=O)O |
| InChI | InChI=1S/C6H10O10P2/c7-3(1-15-17(11)12)5(9)6(10)4(8)2-16-18(13)14/h3,5-7,9-10H,1-2H2/p+2/t3-,5+,6-/m1/s1 |
| InChIKey | MGKIJNOYFXTAKJ-PQLUHFTBSA-P |
| XLogP | -2.03 |
| TPSA | 170.82 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.10 |
| LogP ≤ 5 | -2.03 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|