C7H15O8P — CID 102452330
[(2R,3R,4S)-2,3,4-trihydroxy-5-oxoheptyl] dihydrogen phosphate (PubChem CID 102452330) has the molecular formula C7H15O8P and a molecular weight of 258.16 g/mol. Its IUPAC name is [(2R,3R,4S)-2,3,4-trihydroxy-5-oxoheptyl] dihydrogen phosphate.
| Compound Name | [(2R,3R,4S)-2,3,4-trihydroxy-5-oxoheptyl] dihydrogen phosphate |
|---|---|
| PubChem CID | 102452330 |
| Molecular Formula | C7H15O8P |
| Molecular Weight | 258.16 g/mol |
| Exact Mass | 258.05 |
| IUPAC Name | [(2R,3R,4S)-2,3,4-trihydroxy-5-oxoheptyl] dihydrogen phosphate |
| SMILES | CCC(=O)[C@@H](O)[C@H](O)[C@H](O)COP(=O)(O)O |
| InChI | InChI=1S/C7H15O8P/c1-2-4(8)6(10)7(11)5(9)3-15-16(12,13)14/h5-7,9-11H,2-3H2,1H3,(H2,12,13,14)/t5-,6-,7-/m1/s1 |
| InChIKey | DZXYOEIXDLKXMH-FSDSQADBSA-N |
| XLogP | -1.84 |
| TPSA | 144.52 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.16 |
| LogP ≤ 5 | -1.84 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|