C5H12NO9P — CID 3286786
[2,3,4-trihydroxy-5-(hydroxyamino)-5-oxopentyl] dihydrogen phosphate (PubChem CID 3286786) has the molecular formula C5H12NO9P and a molecular weight of 261.12 g/mol. Its IUPAC name is [2,3,4-trihydroxy-5-(hydroxyamino)-5-oxopentyl] dihydrogen phosphate.
| Compound Name | [2,3,4-trihydroxy-5-(hydroxyamino)-5-oxopentyl] dihydrogen phosphate |
|---|---|
| PubChem CID | 3286786 |
| Molecular Formula | C5H12NO9P |
| Molecular Weight | 261.12 g/mol |
| Exact Mass | 261.02 |
| IUPAC Name | [2,3,4-trihydroxy-5-(hydroxyamino)-5-oxopentyl] dihydrogen phosphate |
| SMILES | O=C(NO)C(O)C(O)C(O)COP(=O)(O)O |
| InChI | InChI=1S/C5H12NO9P/c7-2(1-15-16(12,13)14)3(8)4(9)5(10)6-11/h2-4,7-9,11H,1H2,(H,6,10)(H2,12,13,14) |
| InChIKey | OHQFMJPEBPCIEQ-UHFFFAOYSA-N |
| XLogP | -3.32 |
| TPSA | 176.78 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.12 |
| LogP ≤ 5 | -3.32 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|