C8H18O14P2 — CID 135053948
[(2R,3R,4R)-2,3,4,5,6-pentahydroxy-7-oxo-8-phosphonooxyoctyl] dihydrogen phosphate (PubChem CID 135053948) has the molecular formula C8H18O14P2 and a molecular weight of 400.17 g/mol. Its IUPAC name is [(2R,3R,4R)-2,3,4,5,6-pentahydroxy-7-oxo-8-phosphonooxyoctyl] dihydrogen phosphate.
| Compound Name | [(2R,3R,4R)-2,3,4,5,6-pentahydroxy-7-oxo-8-phosphonooxyoctyl] dihydrogen phosphate |
|---|---|
| PubChem CID | 135053948 |
| Molecular Formula | C8H18O14P2 |
| Molecular Weight | 400.17 g/mol |
| Exact Mass | 400.02 |
| IUPAC Name | [(2R,3R,4R)-2,3,4,5,6-pentahydroxy-7-oxo-8-phosphonooxyoctyl] dihydrogen phosphate |
| SMILES | O=C(COP(=O)(O)O)C(O)C(O)[C@H](O)[C@H](O)[C@H](O)COP(=O)(O)O |
| InChI | InChI=1S/C8H18O14P2/c9-3(1-21-23(15,16)17)5(11)7(13)8(14)6(12)4(10)2-22-24(18,19)20/h3,5-9,11-14H,1-2H2,(H2,15,16,17)(H2,18,19,20)/t3-,5-,6?,7-,8?/m1/s1 |
| InChIKey | FQNLKWXILWAYPZ-GUQZEMQMSA-N |
| XLogP | -4.42 |
| TPSA | 251.74 Ų |
| H-Bond Donors | 9 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.17 |
| LogP ≤ 5 | -4.42 |
| H-Bond Donors ≤ 5 | 9 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|