C6H14NaO9P — CID 173404445
sodium;hydride;[(2R,3R,4S)-2,3,4,6-tetrahydroxy-5-oxohexyl] dihydrogen phosphate (PubChem CID 173404445) has the molecular formula C6H14NaO9P and a molecular weight of 284.13 g/mol. Its IUPAC name is sodium;hydride;[(2R,3R,4S)-2,3,4,6-tetrahydroxy-5-oxohexyl] dihydrogen phosphate.
| Compound Name | sodium;hydride;[(2R,3R,4S)-2,3,4,6-tetrahydroxy-5-oxohexyl] dihydrogen phosphate |
|---|---|
| PubChem CID | 173404445 |
| Molecular Formula | C6H14NaO9P |
| Molecular Weight | 284.13 g/mol |
| Exact Mass | 284.03 |
| IUPAC Name | sodium;hydride;[(2R,3R,4S)-2,3,4,6-tetrahydroxy-5-oxohexyl] dihydrogen phosphate |
| SMILES | O=C(CO)[C@@H](O)[C@H](O)[C@H](O)COP(=O)(O)O.[H-].[Na+] |
| InChI | InChI=1S/C6H13O9P.Na.H/c7-1-3(8)5(10)6(11)4(9)2-15-16(12,13)14;;/h4-7,9-11H,1-2H2,(H2,12,13,14);;/q;+1;-1/t4-,5-,6-;;/m1../s1 |
| InChIKey | XFXYRUPTSHRQPS-CCXTYWFUSA-N |
| XLogP | -6.14 |
| TPSA | 164.75 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.13 |
| LogP ≤ 5 | -6.14 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|