C4H8O6P+ — CID 57370366
[(3R)-3,4-dihydroxy-2-oxobutoxy]-hydroxy-oxophosphanium (PubChem CID 57370366) has the molecular formula C4H8O6P+ and a molecular weight of 183.08 g/mol. Its IUPAC name is [(3R)-3,4-dihydroxy-2-oxobutoxy]-hydroxy-oxophosphanium.
| Compound Name | [(3R)-3,4-dihydroxy-2-oxobutoxy]-hydroxy-oxophosphanium |
|---|---|
| PubChem CID | 57370366 |
| Molecular Formula | C4H8O6P+ |
| Molecular Weight | 183.08 g/mol |
| Exact Mass | 183.01 |
| IUPAC Name | [(3R)-3,4-dihydroxy-2-oxobutoxy]-hydroxy-oxophosphanium |
| SMILES | O=C(CO[P+](=O)O)[C@H](O)CO |
| InChI | InChI=1S/C4H7O6P/c5-1-3(6)4(7)2-10-11(8)9/h3,5-6H,1-2H2/p+1/t3-/m1/s1 |
| InChIKey | MTHNEVOGPPIWLJ-GSVOUGTGSA-O |
| XLogP | -1.42 |
| TPSA | 104.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 183.08 |
| LogP ≤ 5 | -1.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|