About (4S)-1,2,4,5-tetrahydroxypentan-3-one
(4S)-1,2,4,5-tetrahydroxypentan-3-one (PubChem CID 54455604) has the molecular formula C5H10O5
and a molecular weight of 150.13 g/mol. Its IUPAC name is (4S)-1,2,4,5-tetrahydroxypentan-3-one.
Molecular Properties
| Compound Name | (4S)-1,2,4,5-tetrahydroxypentan-3-one |
| PubChem CID | 54455604 |
| Molecular Formula | C5H10O5 |
| Molecular Weight | 150.13 g/mol |
| Exact Mass | 150.05 |
| IUPAC Name | (4S)-1,2,4,5-tetrahydroxypentan-3-one |
| SMILES | O=C(C(O)CO)[C@@H](O)CO |
| InChI | InChI=1S/C5H10O5/c6-1-3(8)5(10)4(9)2-7/h3-4,6-9H,1-2H2/t3-,4?/m0/s1 |
| InChIKey | WXYXERHRDKEISL-WUCPZUCCSA-N |
| XLogP | -2.74 |
| TPSA | 97.99 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 150.13 |
| LogP ≤ 5 | -2.74 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze (4S)-1,2,4,5-tetrahydroxypentan-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4S)-1,2,4,5-tetrahydroxypentan-3-one?
The IUPAC name of (4S)-1,2,4,5-tetrahydroxypentan-3-one (CID 54455604) is (4S)-1,2,4,5-tetrahydroxypentan-3-one.
What is the SMILES notation for (4S)-1,2,4,5-tetrahydroxypentan-3-one?
The canonical SMILES for (4S)-1,2,4,5-tetrahydroxypentan-3-one is O=C(C(O)CO)[C@@H](O)CO.
What is the InChIKey of (4S)-1,2,4,5-tetrahydroxypentan-3-one?
The InChIKey is WXYXERHRDKEISL-WUCPZUCCSA-N. The full InChI is InChI=1S/C5H10O5/c6-1-3(8)5(10)4(9)2-7/h3-4,6-9H,1-2H2/t3-,4?/m0/s1.
What are the key properties of (4S)-1,2,4,5-tetrahydroxypentan-3-one?
(4S)-1,2,4,5-tetrahydroxypentan-3-one has a molecular weight of 150.13 g/mol, XLogP of -2.74, 4 rotatable bonds, 4 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (4S)-1,2,4,5-tetrahydroxypentan-3-one is sourced from PubChem (CID 54455604), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).