C5H11NO5 — CID 123362712
(2R,4S)-1,2,4-trihydroxy-5-(hydroxyamino)pentan-3-one (PubChem CID 123362712) has the molecular formula C5H11NO5 and a molecular weight of 165.14 g/mol. Its IUPAC name is (2R,4S)-1,2,4-trihydroxy-5-(hydroxyamino)pentan-3-one.
| Compound Name | (2R,4S)-1,2,4-trihydroxy-5-(hydroxyamino)pentan-3-one |
|---|---|
| PubChem CID | 123362712 |
| Molecular Formula | C5H11NO5 |
| Molecular Weight | 165.14 g/mol |
| Exact Mass | 165.06 |
| IUPAC Name | (2R,4S)-1,2,4-trihydroxy-5-(hydroxyamino)pentan-3-one |
| SMILES | O=C([C@H](O)CO)[C@@H](O)CNO |
| InChI | InChI=1S/C5H11NO5/c7-2-4(9)5(10)3(8)1-6-11/h3-4,6-9,11H,1-2H2/t3-,4+/m0/s1 |
| InChIKey | DZJCICDUSGRJMG-IUYQGCFVSA-N |
| XLogP | -2.75 |
| TPSA | 110.02 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 165.14 |
| LogP ≤ 5 | -2.75 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|