C6H10CdO8 — CID 175584526
cadmium(2+);bis(2,3-dihydroxypropanoate) (PubChem CID 175584526) has the molecular formula C6H10CdO8 and a molecular weight of 322.55 g/mol. Its IUPAC name is cadmium(2+);bis(2,3-dihydroxypropanoate).
| Compound Name | cadmium(2+);bis(2,3-dihydroxypropanoate) |
|---|---|
| PubChem CID | 175584526 |
| Molecular Formula | C6H10CdO8 |
| Molecular Weight | 322.55 g/mol |
| Exact Mass | 323.94 |
| IUPAC Name | cadmium(2+);bis(2,3-dihydroxypropanoate) |
| SMILES | O=C([O-])C(O)CO.O=C([O-])C(O)CO.[Cd+2] |
| InChI | InChI=1S/2C3H6O4.Cd/c2*4-1-2(5)3(6)7;/h2*2,4-5H,1H2,(H,6,7);/q;;+2/p-2 |
| InChIKey | JWYDPTLHRKLLDP-UHFFFAOYSA-L |
| XLogP | -5.82 |
| TPSA | 161.18 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.55 |
| LogP ≤ 5 | -5.82 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |