About cadmium(2+);2-hydroxybutanedioate
cadmium(2+);2-hydroxybutanedioate (PubChem CID 87607349) has the molecular formula C4H4CdO5
and a molecular weight of 244.48 g/mol. Its IUPAC name is cadmium(2+);2-hydroxybutanedioate.
Molecular Properties
| Compound Name | cadmium(2+);2-hydroxybutanedioate |
| PubChem CID | 87607349 |
| Molecular Formula | C4H4CdO5 |
| Molecular Weight | 244.48 g/mol |
| Exact Mass | 245.91 |
| IUPAC Name | cadmium(2+);2-hydroxybutanedioate |
| SMILES | O=C([O-])CC(O)C(=O)[O-].[Cd+2] |
| InChI | InChI=1S/C4H6O5.Cd/c5-2(4(8)9)1-3(6)7;/h2,5H,1H2,(H,6,7)(H,8,9);/q;+2/p-2 |
| InChIKey | JEOYJRCIDQRRNG-UHFFFAOYSA-L |
| XLogP | -3.77 |
| TPSA | 100.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 244.48 |
| LogP ≤ 5 | -3.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze cadmium(2+);2-hydroxybutanedioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cadmium(2+);2-hydroxybutanedioate?
The IUPAC name of cadmium(2+);2-hydroxybutanedioate (CID 87607349) is cadmium(2+);2-hydroxybutanedioate.
What is the SMILES notation for cadmium(2+);2-hydroxybutanedioate?
The canonical SMILES for cadmium(2+);2-hydroxybutanedioate is O=C([O-])CC(O)C(=O)[O-].[Cd+2].
What is the InChIKey of cadmium(2+);2-hydroxybutanedioate?
The InChIKey is JEOYJRCIDQRRNG-UHFFFAOYSA-L. The full InChI is InChI=1S/C4H6O5.Cd/c5-2(4(8)9)1-3(6)7;/h2,5H,1H2,(H,6,7)(H,8,9);/q;+2/p-2.
What are the key properties of cadmium(2+);2-hydroxybutanedioate?
cadmium(2+);2-hydroxybutanedioate has a molecular weight of 244.48 g/mol, XLogP of -3.77, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for cadmium(2+);2-hydroxybutanedioate is sourced from PubChem (CID 87607349), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).