About 2-hydroxybutanedioate;oxozirconium(2+)
2-hydroxybutanedioate;oxozirconium(2+) (PubChem CID 87184139) has the molecular formula C4H4O6Zr
and a molecular weight of 239.29 g/mol. Its IUPAC name is 2-hydroxybutanedioate;oxozirconium(2+).
Molecular Properties
| Compound Name | 2-hydroxybutanedioate;oxozirconium(2+) |
| PubChem CID | 87184139 |
| Molecular Formula | C4H4O6Zr |
| Molecular Weight | 239.29 g/mol |
| Exact Mass | 237.91 |
| IUPAC Name | 2-hydroxybutanedioate;oxozirconium(2+) |
| SMILES | O=C([O-])CC(O)C(=O)[O-].O=[Zr+2] |
| InChI | InChI=1S/C4H6O5.O.Zr/c5-2(4(8)9)1-3(6)7;;/h2,5H,1H2,(H,6,7)(H,8,9);;/q;;+2/p-2 |
| InChIKey | IPSQGRAXQAJSFR-UHFFFAOYSA-L |
| XLogP | -3.88 |
| TPSA | 117.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 239.29 |
| LogP ≤ 5 | -3.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 2-hydroxybutanedioate;oxozirconium(2+) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-hydroxybutanedioate;oxozirconium(2+)?
The IUPAC name of 2-hydroxybutanedioate;oxozirconium(2+) (CID 87184139) is 2-hydroxybutanedioate;oxozirconium(2+).
What is the SMILES notation for 2-hydroxybutanedioate;oxozirconium(2+)?
The canonical SMILES for 2-hydroxybutanedioate;oxozirconium(2+) is O=C([O-])CC(O)C(=O)[O-].O=[Zr+2].
What is the InChIKey of 2-hydroxybutanedioate;oxozirconium(2+)?
The InChIKey is IPSQGRAXQAJSFR-UHFFFAOYSA-L. The full InChI is InChI=1S/C4H6O5.O.Zr/c5-2(4(8)9)1-3(6)7;;/h2,5H,1H2,(H,6,7)(H,8,9);;/q;;+2/p-2.
What are the key properties of 2-hydroxybutanedioate;oxozirconium(2+)?
2-hydroxybutanedioate;oxozirconium(2+) has a molecular weight of 239.29 g/mol, XLogP of -3.88, 3 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-hydroxybutanedioate;oxozirconium(2+) is sourced from PubChem (CID 87184139), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).