C8H10Na2O11 — CID 175410241
disodium;2,3-dihydroxybutanedioic acid;2-hydroxybutanedioate (PubChem CID 175410241) has the molecular formula C8H10Na2O11 and a molecular weight of 328.14 g/mol. Its IUPAC name is disodium;2,3-dihydroxybutanedioic acid;2-hydroxybutanedioate.
| Compound Name | disodium;2,3-dihydroxybutanedioic acid;2-hydroxybutanedioate |
|---|---|
| PubChem CID | 175410241 |
| Molecular Formula | C8H10Na2O11 |
| Molecular Weight | 328.14 g/mol |
| Exact Mass | 328.00 |
| IUPAC Name | disodium;2,3-dihydroxybutanedioic acid;2-hydroxybutanedioate |
| SMILES | O=C(O)C(O)C(O)C(=O)O.O=C([O-])CC(O)C(=O)[O-].[Na+].[Na+] |
| InChI | InChI=1S/C4H6O6.C4H6O5.2Na/c5-1(3(7)8)2(6)4(9)10;5-2(4(8)9)1-3(6)7;;/h1-2,5-6H,(H,7,8)(H,9,10);2,5H,1H2,(H,6,7)(H,8,9);;/q;;2*+1/p-2 |
| InChIKey | IMIYGRQCCBRJFC-UHFFFAOYSA-L |
| XLogP | -11.88 |
| TPSA | 215.55 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.14 |
| LogP ≤ 5 | -11.88 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |