C4H5NaO5 — CID 24802275
sodium (3S)-3,4-dihydroxy-4-oxobutanoate (PubChem CID 24802275) has the molecular formula C4H5NaO5 and a molecular weight of 156.07 g/mol. Its IUPAC name is sodium (3S)-3,4-dihydroxy-4-oxobutanoate.
| Compound Name | sodium (3S)-3,4-dihydroxy-4-oxobutanoate |
|---|---|
| PubChem CID | 24802275 |
| Molecular Formula | C4H5NaO5 |
| Molecular Weight | 156.07 g/mol |
| Exact Mass | 156.00 |
| IUPAC Name | sodium (3S)-3,4-dihydroxy-4-oxobutanoate |
| SMILES | O=C([O-])C[C@H](O)C(=O)O.[Na+] |
| InChI | InChI=1S/C4H6O5.Na/c5-2(4(8)9)1-3(6)7;/h2,5H,1H2,(H,6,7)(H,8,9);/q;+1/p-1/t2-;/m0./s1 |
| InChIKey | DOJOZCIMYABYPO-DKWTVANSSA-M |
| XLogP | -5.42 |
| TPSA | 97.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 156.07 |
| LogP ≤ 5 | -5.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |