About sodium;2-hydroxybutanedioate;dihydrate
sodium;2-hydroxybutanedioate;dihydrate (PubChem CID 22761792) has the molecular formula C4H8NaO7-
and a molecular weight of 191.09 g/mol. Its IUPAC name is sodium;2-hydroxybutanedioate;dihydrate.
Molecular Properties
| Compound Name | sodium;2-hydroxybutanedioate;dihydrate |
| PubChem CID | 22761792 |
| Molecular Formula | C4H8NaO7- |
| Molecular Weight | 191.09 g/mol |
| Exact Mass | 191.02 |
| IUPAC Name | sodium;2-hydroxybutanedioate;dihydrate |
| SMILES | O.O.O=C([O-])CC(O)C(=O)[O-].[Na+] |
| InChI | InChI=1S/C4H6O5.Na.2H2O/c5-2(4(8)9)1-3(6)7;;;/h2,5H,1H2,(H,6,7)(H,8,9);;2*1H2/q;+1;;/p-2 |
| InChIKey | ASVDLBFHXKXPER-UHFFFAOYSA-L |
| XLogP | -8.41 |
| TPSA | 163.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 191.09 |
| LogP ≤ 5 | -8.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze sodium;2-hydroxybutanedioate;dihydrate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of sodium;2-hydroxybutanedioate;dihydrate?
The IUPAC name of sodium;2-hydroxybutanedioate;dihydrate (CID 22761792) is sodium;2-hydroxybutanedioate;dihydrate.
What is the SMILES notation for sodium;2-hydroxybutanedioate;dihydrate?
The canonical SMILES for sodium;2-hydroxybutanedioate;dihydrate is O.O.O=C([O-])CC(O)C(=O)[O-].[Na+].
What is the InChIKey of sodium;2-hydroxybutanedioate;dihydrate?
The InChIKey is ASVDLBFHXKXPER-UHFFFAOYSA-L. The full InChI is InChI=1S/C4H6O5.Na.2H2O/c5-2(4(8)9)1-3(6)7;;;/h2,5H,1H2,(H,6,7)(H,8,9);;2*1H2/q;+1;;/p-2.
What are the key properties of sodium;2-hydroxybutanedioate;dihydrate?
sodium;2-hydroxybutanedioate;dihydrate has a molecular weight of 191.09 g/mol, XLogP of -8.41, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for sodium;2-hydroxybutanedioate;dihydrate is sourced from PubChem (CID 22761792), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).