About azanium;sodium;(2S)-2-hydroxybutanedioate
azanium;sodium;(2S)-2-hydroxybutanedioate (PubChem CID 141157633) has the molecular formula C4H8NNaO5
and a molecular weight of 173.10 g/mol. Its IUPAC name is azanium;sodium;(2S)-2-hydroxybutanedioate.
Molecular Properties
| Compound Name | azanium;sodium;(2S)-2-hydroxybutanedioate |
| PubChem CID | 141157633 |
| Molecular Formula | C4H8NNaO5 |
| Molecular Weight | 173.10 g/mol |
| Exact Mass | 173.03 |
| IUPAC Name | azanium;sodium;(2S)-2-hydroxybutanedioate |
| SMILES | O=C([O-])C[C@H](O)C(=O)[O-].[NH4+].[Na+] |
| InChI | InChI=1S/C4H6O5.H3N.Na/c5-2(4(8)9)1-3(6)7;;/h2,5H,1H2,(H,6,7)(H,8,9);1H3;/q;;+1/p-1/t2-;;/m0../s1 |
| InChIKey | HQUOCDGAZSRDSU-JIZZDEOASA-M |
| XLogP | -6.38 |
| TPSA | 136.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 173.10 |
| LogP ≤ 5 | -6.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze azanium;sodium;(2S)-2-hydroxybutanedioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of azanium;sodium;(2S)-2-hydroxybutanedioate?
The IUPAC name of azanium;sodium;(2S)-2-hydroxybutanedioate (CID 141157633) is azanium;sodium;(2S)-2-hydroxybutanedioate.
What is the SMILES notation for azanium;sodium;(2S)-2-hydroxybutanedioate?
The canonical SMILES for azanium;sodium;(2S)-2-hydroxybutanedioate is O=C([O-])C[C@H](O)C(=O)[O-].[NH4+].[Na+].
What is the InChIKey of azanium;sodium;(2S)-2-hydroxybutanedioate?
The InChIKey is HQUOCDGAZSRDSU-JIZZDEOASA-M. The full InChI is InChI=1S/C4H6O5.H3N.Na/c5-2(4(8)9)1-3(6)7;;/h2,5H,1H2,(H,6,7)(H,8,9);1H3;/q;;+1/p-1/t2-;;/m0../s1.
What are the key properties of azanium;sodium;(2S)-2-hydroxybutanedioate?
azanium;sodium;(2S)-2-hydroxybutanedioate has a molecular weight of 173.10 g/mol, XLogP of -6.38, 3 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for azanium;sodium;(2S)-2-hydroxybutanedioate is sourced from PubChem (CID 141157633), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).