C8H17NO5 — CID 139832074
3,4-dihydroxy-4-oxobutanoate;tetramethylazanium (PubChem CID 139832074) has the molecular formula C8H17NO5 and a molecular weight of 207.23 g/mol. Its IUPAC name is 3,4-dihydroxy-4-oxobutanoate;tetramethylazanium.
| Compound Name | 3,4-dihydroxy-4-oxobutanoate;tetramethylazanium |
|---|---|
| PubChem CID | 139832074 |
| Molecular Formula | C8H17NO5 |
| Molecular Weight | 207.23 g/mol |
| Exact Mass | 207.11 |
| IUPAC Name | 3,4-dihydroxy-4-oxobutanoate;tetramethylazanium |
| SMILES | C[N+](C)(C)C.O=C([O-])CC(O)C(=O)O |
| InChI | InChI=1S/C4H12N.C4H6O5/c1-5(2,3)4;5-2(4(8)9)1-3(6)7/h1-4H3;2,5H,1H2,(H,6,7)(H,8,9)/q+1;/p-1 |
| InChIKey | JHWYGMIOBXLXQW-UHFFFAOYSA-M |
| XLogP | -2.11 |
| TPSA | 97.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.23 |
| LogP ≤ 5 | -2.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|