C8H14O10-2 — CID 162224671
(2R,3S)-2,3,4-trihydroxybutanoate (PubChem CID 162224671) has the molecular formula C8H14O10-2 and a molecular weight of 270.19 g/mol. Its IUPAC name is (2R,3S)-2,3,4-trihydroxybutanoate.
| Compound Name | (2R,3S)-2,3,4-trihydroxybutanoate |
|---|---|
| PubChem CID | 162224671 |
| Molecular Formula | C8H14O10-2 |
| Molecular Weight | 270.19 g/mol |
| Exact Mass | 270.06 |
| IUPAC Name | (2R,3S)-2,3,4-trihydroxybutanoate |
| SMILES | O=C([O-])[C@H](O)[C@@H](O)CO.O=C([O-])[C@H](O)[C@@H](O)CO |
| InChI | InChI=1S/2C4H8O5/c2*5-1-2(6)3(7)4(8)9/h2*2-3,5-7H,1H2,(H,8,9)/p-2/t2*2-,3+/m00/s1 |
| InChIKey | ZUPASSQBXSJDLS-ULVVOCQISA-L |
| XLogP | -7.10 |
| TPSA | 201.64 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.19 |
| LogP ≤ 5 | -7.10 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 10 |