C5H7IO4 — CID 87997526
4,5-dihydroxy-1-iodopentane-2,3-dione (PubChem CID 87997526) has the molecular formula C5H7IO4 and a molecular weight of 258.01 g/mol. Its IUPAC name is 4,5-dihydroxy-1-iodopentane-2,3-dione.
| Compound Name | 4,5-dihydroxy-1-iodopentane-2,3-dione |
|---|---|
| PubChem CID | 87997526 |
| Molecular Formula | C5H7IO4 |
| Molecular Weight | 258.01 g/mol |
| Exact Mass | 257.94 |
| IUPAC Name | 4,5-dihydroxy-1-iodopentane-2,3-dione |
| SMILES | O=C(CI)C(=O)C(O)CO |
| InChI | InChI=1S/C5H7IO4/c6-1-3(8)5(10)4(9)2-7/h4,7,9H,1-2H2 |
| InChIKey | NQKUETVHPPFLPN-UHFFFAOYSA-N |
| XLogP | -1.09 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.01 |
| LogP ≤ 5 | -1.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|