C8H14O5 — CID 123622046
(2R)-1,2,5-trihydroxyoctane-3,4-dione (PubChem CID 123622046) has the molecular formula C8H14O5 and a molecular weight of 190.19 g/mol. Its IUPAC name is (2R)-1,2,5-trihydroxyoctane-3,4-dione.
| Compound Name | (2R)-1,2,5-trihydroxyoctane-3,4-dione |
|---|---|
| PubChem CID | 123622046 |
| Molecular Formula | C8H14O5 |
| Molecular Weight | 190.19 g/mol |
| Exact Mass | 190.08 |
| IUPAC Name | (2R)-1,2,5-trihydroxyoctane-3,4-dione |
| SMILES | CCCC(O)C(=O)C(=O)[C@H](O)CO |
| InChI | InChI=1S/C8H14O5/c1-2-3-5(10)7(12)8(13)6(11)4-9/h5-6,9-11H,2-4H2,1H3/t5?,6-/m1/s1 |
| InChIKey | QRZSNYSUFRMYEA-PRJDIBJQSA-N |
| XLogP | -1.36 |
| TPSA | 94.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 190.19 |
| LogP ≤ 5 | -1.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|