About 3-hydroxy-2-oxohexanoic acid
3-hydroxy-2-oxohexanoic acid (PubChem CID 15110558) has the molecular formula C6H10O4
and a molecular weight of 146.14 g/mol. Its IUPAC name is 3-hydroxy-2-oxohexanoic acid.
Molecular Properties
| Compound Name | 3-hydroxy-2-oxohexanoic acid |
| PubChem CID | 15110558 |
| Molecular Formula | C6H10O4 |
| Molecular Weight | 146.14 g/mol |
| Exact Mass | 146.06 |
| IUPAC Name | 3-hydroxy-2-oxohexanoic acid |
| SMILES | CCCC(O)C(=O)C(=O)O |
| InChI | InChI=1S/C6H10O4/c1-2-3-4(7)5(8)6(9)10/h4,7H,2-3H2,1H3,(H,9,10) |
| InChIKey | FFNGFKBTYNQOOP-UHFFFAOYSA-N |
| XLogP | -0.20 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 146.14 |
| LogP ≤ 5 | -0.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|
Analyze 3-hydroxy-2-oxohexanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-hydroxy-2-oxohexanoic acid?
The IUPAC name of 3-hydroxy-2-oxohexanoic acid (CID 15110558) is 3-hydroxy-2-oxohexanoic acid.
What is the SMILES notation for 3-hydroxy-2-oxohexanoic acid?
The canonical SMILES for 3-hydroxy-2-oxohexanoic acid is CCCC(O)C(=O)C(=O)O.
What is the InChIKey of 3-hydroxy-2-oxohexanoic acid?
The InChIKey is FFNGFKBTYNQOOP-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H10O4/c1-2-3-4(7)5(8)6(9)10/h4,7H,2-3H2,1H3,(H,9,10).
What are the key properties of 3-hydroxy-2-oxohexanoic acid?
3-hydroxy-2-oxohexanoic acid has a molecular weight of 146.14 g/mol, XLogP of -0.20, 4 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-hydroxy-2-oxohexanoic acid is sourced from PubChem (CID 15110558), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).