C6H10O4 — CID 172710843
4,4-dideuterio-3-hydroxy-2-oxohexanoic acid (PubChem CID 172710843) has the molecular formula C6H10O4 and a molecular weight of 148.15 g/mol. Its IUPAC name is 4,4-dideuterio-3-hydroxy-2-oxohexanoic acid.
| Compound Name | 4,4-dideuterio-3-hydroxy-2-oxohexanoic acid |
|---|---|
| PubChem CID | 172710843 |
| Molecular Formula | C6H10O4 |
| Molecular Weight | 148.15 g/mol |
| Exact Mass | 148.07 |
| IUPAC Name | 4,4-dideuterio-3-hydroxy-2-oxohexanoic acid |
| SMILES | [2H]C([2H])(CC)C(O)C(=O)C(=O)O |
| InChI | InChI=1S/C6H10O4/c1-2-3-4(7)5(8)6(9)10/h4,7H,2-3H2,1H3,(H,9,10)/i3D2 |
| InChIKey | FFNGFKBTYNQOOP-SMZGMGDZSA-N |
| XLogP | -0.20 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 148.15 |
| LogP ≤ 5 | -0.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|