About 2-deuteriopropanoic acid;yttrium
2-deuteriopropanoic acid;yttrium (PubChem CID 59959349) has the molecular formula C3H6O2Y
and a molecular weight of 163.99 g/mol. Its IUPAC name is 2-deuteriopropanoic acid;yttrium.
Molecular Properties
| Compound Name | 2-deuteriopropanoic acid;yttrium |
| PubChem CID | 59959349 |
| Molecular Formula | C3H6O2Y |
| Molecular Weight | 163.99 g/mol |
| Exact Mass | 163.95 |
| IUPAC Name | 2-deuteriopropanoic acid;yttrium |
| SMILES | [2H]C(C)C(=O)O.[Y] |
| InChI | InChI=1S/C3H6O2.Y/c1-2-3(4)5;/h2H2,1H3,(H,4,5);/i2D; |
| InChIKey | JWHSHSIDBNVKTJ-YPAXDSTQSA-N |
| XLogP | 0.48 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 6 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 163.99 |
| LogP ≤ 5 | 0.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 2-deuteriopropanoic acid;yttrium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-deuteriopropanoic acid;yttrium?
The IUPAC name of 2-deuteriopropanoic acid;yttrium (CID 59959349) is 2-deuteriopropanoic acid;yttrium.
What is the SMILES notation for 2-deuteriopropanoic acid;yttrium?
The canonical SMILES for 2-deuteriopropanoic acid;yttrium is [2H]C(C)C(=O)O.[Y].
What is the InChIKey of 2-deuteriopropanoic acid;yttrium?
The InChIKey is JWHSHSIDBNVKTJ-YPAXDSTQSA-N. The full InChI is InChI=1S/C3H6O2.Y/c1-2-3(4)5;/h2H2,1H3,(H,4,5);/i2D;.
What are the key properties of 2-deuteriopropanoic acid;yttrium?
2-deuteriopropanoic acid;yttrium has a molecular weight of 163.99 g/mol, XLogP of 0.48, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-deuteriopropanoic acid;yttrium is sourced from PubChem (CID 59959349), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).