About 3-deuteriobutan-2-one;propane
3-deuteriobutan-2-one;propane (PubChem CID 158792015) has the molecular formula C7H16O
and a molecular weight of 117.21 g/mol. Its IUPAC name is 3-deuteriobutan-2-one;propane.
Molecular Properties
| Compound Name | 3-deuteriobutan-2-one;propane |
| PubChem CID | 158792015 |
| Molecular Formula | C7H16O |
| Molecular Weight | 117.21 g/mol |
| Exact Mass | 117.13 |
| IUPAC Name | 3-deuteriobutan-2-one;propane |
| SMILES | CCC.[2H]C(C)C(C)=O |
| InChI | InChI=1S/C4H8O.C3H8/c1-3-4(2)5;1-3-2/h3H2,1-2H3;3H2,1-2H3/i3D; |
| InChIKey | ISJYVOPTUYEVNM-RFQDWOGUSA-N |
| XLogP | 2.40 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 117.21 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 3-deuteriobutan-2-one;propane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-deuteriobutan-2-one;propane?
The IUPAC name of 3-deuteriobutan-2-one;propane (CID 158792015) is 3-deuteriobutan-2-one;propane.
What is the SMILES notation for 3-deuteriobutan-2-one;propane?
The canonical SMILES for 3-deuteriobutan-2-one;propane is CCC.[2H]C(C)C(C)=O.
What is the InChIKey of 3-deuteriobutan-2-one;propane?
The InChIKey is ISJYVOPTUYEVNM-RFQDWOGUSA-N. The full InChI is InChI=1S/C4H8O.C3H8/c1-3-4(2)5;1-3-2/h3H2,1-2H3;3H2,1-2H3/i3D;.
What are the key properties of 3-deuteriobutan-2-one;propane?
3-deuteriobutan-2-one;propane has a molecular weight of 117.21 g/mol, XLogP of 2.40, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-deuteriobutan-2-one;propane is sourced from PubChem (CID 158792015), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).