About 4-deuteriohexan-2-one
4-deuteriohexan-2-one (PubChem CID 59118879) has the molecular formula C6H12O
and a molecular weight of 101.17 g/mol. Its IUPAC name is 4-deuteriohexan-2-one.
Molecular Properties
| Compound Name | 4-deuteriohexan-2-one |
| PubChem CID | 59118879 |
| Molecular Formula | C6H12O |
| Molecular Weight | 101.17 g/mol |
| Exact Mass | 101.10 |
| IUPAC Name | 4-deuteriohexan-2-one |
| SMILES | [2H]C(CC)CC(C)=O |
| InChI | InChI=1S/C6H12O/c1-3-4-5-6(2)7/h3-5H2,1-2H3/i4D |
| InChIKey | QQZOPKMRPOGIEB-QYKNYGDISA-N |
| XLogP | 1.77 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 101.17 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 4-deuteriohexan-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-deuteriohexan-2-one?
The IUPAC name of 4-deuteriohexan-2-one (CID 59118879) is 4-deuteriohexan-2-one.
What is the SMILES notation for 4-deuteriohexan-2-one?
The canonical SMILES for 4-deuteriohexan-2-one is [2H]C(CC)CC(C)=O.
What is the InChIKey of 4-deuteriohexan-2-one?
The InChIKey is QQZOPKMRPOGIEB-QYKNYGDISA-N. The full InChI is InChI=1S/C6H12O/c1-3-4-5-6(2)7/h3-5H2,1-2H3/i4D.
What are the key properties of 4-deuteriohexan-2-one?
4-deuteriohexan-2-one has a molecular weight of 101.17 g/mol, XLogP of 1.77, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4-deuteriohexan-2-one is sourced from PubChem (CID 59118879), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).