About 3-deuteriobutan-2-one
3-deuteriobutan-2-one (PubChem CID 159540848) has the molecular formula C12H24O3
and a molecular weight of 219.34 g/mol. Its IUPAC name is 3-deuteriobutan-2-one.
Molecular Properties
| Compound Name | 3-deuteriobutan-2-one |
| PubChem CID | 159540848 |
| Molecular Formula | C12H24O3 |
| Molecular Weight | 219.34 g/mol |
| Exact Mass | 219.19 |
| IUPAC Name | 3-deuteriobutan-2-one |
| SMILES | [2H]C(C)C(C)=O.[2H]C(C)C(C)=O.[2H]C(C)C(C)=O |
| InChI | InChI=1S/3C4H8O/c3*1-3-4(2)5/h3*3H2,1-2H3/i3*3D |
| InChIKey | MEENJDZJEGEJAI-IOIOKMAKSA-N |
| XLogP | 2.96 |
| TPSA | 51.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 219.34 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-deuteriobutan-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-deuteriobutan-2-one?
The IUPAC name of 3-deuteriobutan-2-one (CID 159540848) is 3-deuteriobutan-2-one.
What is the SMILES notation for 3-deuteriobutan-2-one?
The canonical SMILES for 3-deuteriobutan-2-one is [2H]C(C)C(C)=O.[2H]C(C)C(C)=O.[2H]C(C)C(C)=O.
What is the InChIKey of 3-deuteriobutan-2-one?
The InChIKey is MEENJDZJEGEJAI-IOIOKMAKSA-N. The full InChI is InChI=1S/3C4H8O/c3*1-3-4(2)5/h3*3H2,1-2H3/i3*3D.
What are the key properties of 3-deuteriobutan-2-one?
3-deuteriobutan-2-one has a molecular weight of 219.34 g/mol, XLogP of 2.96, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-deuteriobutan-2-one is sourced from PubChem (CID 159540848), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).