About 1-bromo-1,1-dideuteriopropan-2-one
1-bromo-1,1-dideuteriopropan-2-one (PubChem CID 161368920) has the molecular formula C3H5BrO
and a molecular weight of 138.99 g/mol. Its IUPAC name is 1-bromo-1,1-dideuteriopropan-2-one.
Molecular Properties
| Compound Name | 1-bromo-1,1-dideuteriopropan-2-one |
| PubChem CID | 161368920 |
| Molecular Formula | C3H5BrO |
| Molecular Weight | 138.99 g/mol |
| Exact Mass | 137.96 |
| IUPAC Name | 1-bromo-1,1-dideuteriopropan-2-one |
| SMILES | [2H]C([2H])(Br)C(C)=O |
| InChI | InChI=1S/C3H5BrO/c1-3(5)2-4/h2H2,1H3/i2D2 |
| InChIKey | VQFAIAKCILWQPZ-CBTSVUPCSA-N |
| XLogP | 0.97 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 5 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 138.99 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 1-bromo-1,1-dideuteriopropan-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-bromo-1,1-dideuteriopropan-2-one?
The IUPAC name of 1-bromo-1,1-dideuteriopropan-2-one (CID 161368920) is 1-bromo-1,1-dideuteriopropan-2-one.
What is the SMILES notation for 1-bromo-1,1-dideuteriopropan-2-one?
The canonical SMILES for 1-bromo-1,1-dideuteriopropan-2-one is [2H]C([2H])(Br)C(C)=O.
What is the InChIKey of 1-bromo-1,1-dideuteriopropan-2-one?
The InChIKey is VQFAIAKCILWQPZ-CBTSVUPCSA-N. The full InChI is InChI=1S/C3H5BrO/c1-3(5)2-4/h2H2,1H3/i2D2.
What are the key properties of 1-bromo-1,1-dideuteriopropan-2-one?
1-bromo-1,1-dideuteriopropan-2-one has a molecular weight of 138.99 g/mol, XLogP of 0.97, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-bromo-1,1-dideuteriopropan-2-one is sourced from PubChem (CID 161368920), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).