About 1-bromopropan-2-one;hydrofluoride
1-bromopropan-2-one;hydrofluoride (PubChem CID 159011031) has the molecular formula C3H6BrFO
and a molecular weight of 156.98 g/mol. Its IUPAC name is 1-bromopropan-2-one;hydrofluoride.
Molecular Properties
| Compound Name | 1-bromopropan-2-one;hydrofluoride |
| PubChem CID | 159011031 |
| Molecular Formula | C3H6BrFO |
| Molecular Weight | 156.98 g/mol |
| Exact Mass | 155.96 |
| IUPAC Name | 1-bromopropan-2-one;hydrofluoride |
| SMILES | CC(=O)CBr.F |
| InChI | InChI=1S/C3H5BrO.FH/c1-3(5)2-4;/h2H2,1H3;1H |
| InChIKey | CTZJZRXVCYBPAM-UHFFFAOYSA-N |
| XLogP | 1.12 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 6 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 156.98 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 1-bromopropan-2-one;hydrofluoride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-bromopropan-2-one;hydrofluoride?
The IUPAC name of 1-bromopropan-2-one;hydrofluoride (CID 159011031) is 1-bromopropan-2-one;hydrofluoride.
What is the SMILES notation for 1-bromopropan-2-one;hydrofluoride?
The canonical SMILES for 1-bromopropan-2-one;hydrofluoride is CC(=O)CBr.F.
What is the InChIKey of 1-bromopropan-2-one;hydrofluoride?
The InChIKey is CTZJZRXVCYBPAM-UHFFFAOYSA-N. The full InChI is InChI=1S/C3H5BrO.FH/c1-3(5)2-4;/h2H2,1H3;1H.
What are the key properties of 1-bromopropan-2-one;hydrofluoride?
1-bromopropan-2-one;hydrofluoride has a molecular weight of 156.98 g/mol, XLogP of 1.12, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-bromopropan-2-one;hydrofluoride is sourced from PubChem (CID 159011031), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).