About 1-bromopropan-2-one;ethane
1-bromopropan-2-one;ethane (PubChem CID 171800976) has the molecular formula C5H11BrO
and a molecular weight of 167.05 g/mol. Its IUPAC name is 1-bromopropan-2-one;ethane.
Molecular Properties
| Compound Name | 1-bromopropan-2-one;ethane |
| PubChem CID | 171800976 |
| Molecular Formula | C5H11BrO |
| Molecular Weight | 167.05 g/mol |
| Exact Mass | 166.00 |
| IUPAC Name | 1-bromopropan-2-one;ethane |
| SMILES | CC.CC(=O)CBr |
| InChI | InChI=1S/C3H5BrO.C2H6/c1-3(5)2-4;1-2/h2H2,1H3;1-2H3 |
| InChIKey | OOHYWPPZASAKKG-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 167.05 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 1-bromopropan-2-one;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-bromopropan-2-one;ethane?
The IUPAC name of 1-bromopropan-2-one;ethane (CID 171800976) is 1-bromopropan-2-one;ethane.
What is the SMILES notation for 1-bromopropan-2-one;ethane?
The canonical SMILES for 1-bromopropan-2-one;ethane is CC.CC(=O)CBr.
What is the InChIKey of 1-bromopropan-2-one;ethane?
The InChIKey is OOHYWPPZASAKKG-UHFFFAOYSA-N. The full InChI is InChI=1S/C3H5BrO.C2H6/c1-3(5)2-4;1-2/h2H2,1H3;1-2H3.
What are the key properties of 1-bromopropan-2-one;ethane?
1-bromopropan-2-one;ethane has a molecular weight of 167.05 g/mol, XLogP of 2.00, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-bromopropan-2-one;ethane is sourced from PubChem (CID 171800976), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).