About sodium 2-deuteriopropanoate
sodium 2-deuteriopropanoate (PubChem CID 23666812) has the molecular formula C3H5NaO2
and a molecular weight of 97.07 g/mol. Its IUPAC name is sodium 2-deuteriopropanoate.
Molecular Properties
| Compound Name | sodium 2-deuteriopropanoate |
| PubChem CID | 23666812 |
| Molecular Formula | C3H5NaO2 |
| Molecular Weight | 97.07 g/mol |
| Exact Mass | 97.03 |
| IUPAC Name | sodium 2-deuteriopropanoate |
| SMILES | [2H]C(C)C(=O)[O-].[Na+] |
| InChI | InChI=1S/C3H6O2.Na/c1-2-3(4)5;/h2H2,1H3,(H,4,5);/q;+1/p-1/i2D; |
| InChIKey | JXKPEJDQGNYQSM-YPAXDSTQSA-M |
| XLogP | -3.85 |
| TPSA | 40.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 6 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 97.07 |
| LogP ≤ 5 | -3.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze sodium 2-deuteriopropanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of sodium 2-deuteriopropanoate?
The IUPAC name of sodium 2-deuteriopropanoate (CID 23666812) is sodium 2-deuteriopropanoate.
What is the SMILES notation for sodium 2-deuteriopropanoate?
The canonical SMILES for sodium 2-deuteriopropanoate is [2H]C(C)C(=O)[O-].[Na+].
What is the InChIKey of sodium 2-deuteriopropanoate?
The InChIKey is JXKPEJDQGNYQSM-YPAXDSTQSA-M. The full InChI is InChI=1S/C3H6O2.Na/c1-2-3(4)5;/h2H2,1H3,(H,4,5);/q;+1/p-1/i2D;.
What are the key properties of sodium 2-deuteriopropanoate?
sodium 2-deuteriopropanoate has a molecular weight of 97.07 g/mol, XLogP of -3.85, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for sodium 2-deuteriopropanoate is sourced from PubChem (CID 23666812), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).