About 5-deuteriopentan-2-one;ethanamine
5-deuteriopentan-2-one;ethanamine (PubChem CID 91303537) has the molecular formula C7H17NO
and a molecular weight of 132.23 g/mol. Its IUPAC name is 5-deuteriopentan-2-one;ethanamine.
Molecular Properties
| Compound Name | 5-deuteriopentan-2-one;ethanamine |
| PubChem CID | 91303537 |
| Molecular Formula | C7H17NO |
| Molecular Weight | 132.23 g/mol |
| Exact Mass | 132.14 |
| IUPAC Name | 5-deuteriopentan-2-one;ethanamine |
| SMILES | CCN.[2H]CCCC(C)=O |
| InChI | InChI=1S/C5H10O.C2H7N/c1-3-4-5(2)6;1-2-3/h3-4H2,1-2H3;2-3H2,1H3/i1D; |
| InChIKey | JUIGLIAOIMWHJN-RWQOXAPSSA-N |
| XLogP | 1.34 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 132.23 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 5-deuteriopentan-2-one;ethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-deuteriopentan-2-one;ethanamine?
The IUPAC name of 5-deuteriopentan-2-one;ethanamine (CID 91303537) is 5-deuteriopentan-2-one;ethanamine.
What is the SMILES notation for 5-deuteriopentan-2-one;ethanamine?
The canonical SMILES for 5-deuteriopentan-2-one;ethanamine is CCN.[2H]CCCC(C)=O.
What is the InChIKey of 5-deuteriopentan-2-one;ethanamine?
The InChIKey is JUIGLIAOIMWHJN-RWQOXAPSSA-N. The full InChI is InChI=1S/C5H10O.C2H7N/c1-3-4-5(2)6;1-2-3/h3-4H2,1-2H3;2-3H2,1H3/i1D;.
What are the key properties of 5-deuteriopentan-2-one;ethanamine?
5-deuteriopentan-2-one;ethanamine has a molecular weight of 132.23 g/mol, XLogP of 1.34, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-deuteriopentan-2-one;ethanamine is sourced from PubChem (CID 91303537), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).