C8H15O2- — CID 172875389
3,3-dideuterio-2-(1,1-dideuteriopropyl)pentanoate (PubChem CID 172875389) has the molecular formula C8H15O2- and a molecular weight of 147.23 g/mol. Its IUPAC name is 3,3-dideuterio-2-(1,1-dideuteriopropyl)pentanoate.
| Compound Name | 3,3-dideuterio-2-(1,1-dideuteriopropyl)pentanoate |
|---|---|
| PubChem CID | 172875389 |
| Molecular Formula | C8H15O2- |
| Molecular Weight | 147.23 g/mol |
| Exact Mass | 147.13 |
| IUPAC Name | 3,3-dideuterio-2-(1,1-dideuteriopropyl)pentanoate |
| SMILES | [2H]C([2H])(CC)C(C(=O)[O-])C([2H])([2H])CC |
| InChI | InChI=1S/C8H16O2/c1-3-5-7(6-4-2)8(9)10/h7H,3-6H2,1-2H3,(H,9,10)/p-1/i5D2,6D2 |
| InChIKey | NIJJYAXOARWZEE-NZLXMSDQSA-M |
| XLogP | 0.95 |
| TPSA | 40.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 147.23 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |