About 3-chloro-2-oxopentanoic acid
3-chloro-2-oxopentanoic acid (PubChem CID 87224435) has the molecular formula C5H7ClO3
and a molecular weight of 150.56 g/mol. Its IUPAC name is 3-chloro-2-oxopentanoic acid.
Molecular Properties
| Compound Name | 3-chloro-2-oxopentanoic acid |
| PubChem CID | 87224435 |
| Molecular Formula | C5H7ClO3 |
| Molecular Weight | 150.56 g/mol |
| Exact Mass | 150.01 |
| IUPAC Name | 3-chloro-2-oxopentanoic acid |
| SMILES | CCC(Cl)C(=O)C(=O)O |
| InChI | InChI=1S/C5H7ClO3/c1-2-3(6)4(7)5(8)9/h3H,2H2,1H3,(H,8,9) |
| InChIKey | DOVWZAHPBVXVKP-UHFFFAOYSA-N |
| XLogP | 0.66 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 150.56 |
| LogP ≤ 5 | 0.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|
Analyze 3-chloro-2-oxopentanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-chloro-2-oxopentanoic acid?
The IUPAC name of 3-chloro-2-oxopentanoic acid (CID 87224435) is 3-chloro-2-oxopentanoic acid.
What is the SMILES notation for 3-chloro-2-oxopentanoic acid?
The canonical SMILES for 3-chloro-2-oxopentanoic acid is CCC(Cl)C(=O)C(=O)O.
What is the InChIKey of 3-chloro-2-oxopentanoic acid?
The InChIKey is DOVWZAHPBVXVKP-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H7ClO3/c1-2-3(6)4(7)5(8)9/h3H,2H2,1H3,(H,8,9).
What are the key properties of 3-chloro-2-oxopentanoic acid?
3-chloro-2-oxopentanoic acid has a molecular weight of 150.56 g/mol, XLogP of 0.66, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-chloro-2-oxopentanoic acid is sourced from PubChem (CID 87224435), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).