About 2-chlorobutanoate
2-chlorobutanoate (PubChem CID 22062893) has the molecular formula C4H6ClO2-
and a molecular weight of 121.54 g/mol. Its IUPAC name is 2-chlorobutanoate.
Molecular Properties
| Compound Name | 2-chlorobutanoate |
| PubChem CID | 22062893 |
| Molecular Formula | C4H6ClO2- |
| Molecular Weight | 121.54 g/mol |
| Exact Mass | 121.01 |
| IUPAC Name | 2-chlorobutanoate |
| SMILES | CCC(Cl)C(=O)[O-] |
| InChI | InChI=1S/C4H7ClO2/c1-2-3(5)4(6)7/h3H,2H2,1H3,(H,6,7)/p-1 |
| InChIKey | RVBUZBPJAGZHSQ-UHFFFAOYSA-M |
| XLogP | -0.25 |
| TPSA | 40.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 121.54 |
| LogP ≤ 5 | -0.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 2-chlorobutanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-chlorobutanoate?
The IUPAC name of 2-chlorobutanoate (CID 22062893) is 2-chlorobutanoate.
What is the SMILES notation for 2-chlorobutanoate?
The canonical SMILES for 2-chlorobutanoate is CCC(Cl)C(=O)[O-].
What is the InChIKey of 2-chlorobutanoate?
The InChIKey is RVBUZBPJAGZHSQ-UHFFFAOYSA-M. The full InChI is InChI=1S/C4H7ClO2/c1-2-3(5)4(6)7/h3H,2H2,1H3,(H,6,7)/p-1.
What are the key properties of 2-chlorobutanoate?
2-chlorobutanoate has a molecular weight of 121.54 g/mol, XLogP of -0.25, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-chlorobutanoate is sourced from PubChem (CID 22062893), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).