C6H6Cl4HgO4 — CID 22603891
bis(2,3-dichloropropanoate);mercury(2+) (PubChem CID 22603891) has the molecular formula C6H6Cl4HgO4 and a molecular weight of 484.51 g/mol. Its IUPAC name is bis(2,3-dichloropropanoate);mercury(2+).
| Compound Name | bis(2,3-dichloropropanoate);mercury(2+) |
|---|---|
| PubChem CID | 22603891 |
| Molecular Formula | C6H6Cl4HgO4 |
| Molecular Weight | 484.51 g/mol |
| Exact Mass | 483.87 |
| IUPAC Name | bis(2,3-dichloropropanoate);mercury(2+) |
| SMILES | O=C([O-])C(Cl)CCl.O=C([O-])C(Cl)CCl.[Hg+2] |
| InChI | InChI=1S/2C3H4Cl2O2.Hg/c2*4-1-2(5)3(6)7;/h2*2H,1H2,(H,6,7);/q;;+2/p-2 |
| InChIKey | RTQZONMOPSCTTA-UHFFFAOYSA-L |
| XLogP | -0.84 |
| TPSA | 80.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.51 |
| LogP ≤ 5 | -0.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|