About 2-chloropropanedioate
2-chloropropanedioate (PubChem CID 19901306) has the molecular formula C3HClO4-2
and a molecular weight of 136.49 g/mol. Its IUPAC name is 2-chloropropanedioate.
Molecular Properties
| Compound Name | 2-chloropropanedioate |
| PubChem CID | 19901306 |
| Molecular Formula | C3HClO4-2 |
| Molecular Weight | 136.49 g/mol |
| Exact Mass | 135.96 |
| IUPAC Name | 2-chloropropanedioate |
| SMILES | O=C([O-])C(Cl)C(=O)[O-] |
| InChI | InChI=1S/C3H3ClO4/c4-1(2(5)6)3(7)8/h1H,(H,5,6)(H,7,8)/p-2 |
| InChIKey | AFXWHCJMTLWFKF-UHFFFAOYSA-L |
| XLogP | -2.91 |
| TPSA | 80.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 136.49 |
| LogP ≤ 5 | -2.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze 2-chloropropanedioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-chloropropanedioate?
The IUPAC name of 2-chloropropanedioate (CID 19901306) is 2-chloropropanedioate.
What is the SMILES notation for 2-chloropropanedioate?
The canonical SMILES for 2-chloropropanedioate is O=C([O-])C(Cl)C(=O)[O-].
What is the InChIKey of 2-chloropropanedioate?
The InChIKey is AFXWHCJMTLWFKF-UHFFFAOYSA-L. The full InChI is InChI=1S/C3H3ClO4/c4-1(2(5)6)3(7)8/h1H,(H,5,6)(H,7,8)/p-2.
What are the key properties of 2-chloropropanedioate?
2-chloropropanedioate has a molecular weight of 136.49 g/mol, XLogP of -2.91, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-chloropropanedioate is sourced from PubChem (CID 19901306), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).